C30H50O2 — CID 162887037
3-[(1S,2S,4aS,4bS,6aR,7R,10aS,10bR,12aR)-7-hydroxy-1,4a,4b,8,8,10a-hexamethyl-2-prop-1-en-2-yl-3,4,5,6,6a,7,9,10,10b,11,12,12a-dodecahydro-2H-chrysen-1-yl]propanal (PubChem CID 162887037) has the molecular formula C30H50O2 and a molecular weight of 442.73 g/mol. Its IUPAC name is 3-[(1S,2S,4aS,4bS,6aR,7R,10aS,10bR,12aR)-7-hydroxy-1,4a,4b,8,8,10a-hexamethyl-2-prop-1-en-2-yl-3,4,5,6,6a,7,9,10,10b,11,12,12a-dodecahydro-2H-chrysen-1-yl]propanal.
| Compound Name | 3-[(1S,2S,4aS,4bS,6aR,7R,10aS,10bR,12aR)-7-hydroxy-1,4a,4b,8,8,10a-hexamethyl-2-prop-1-en-2-yl-3,4,5,6,6a,7,9,10,10b,11,12,12a-dodecahydro-2H-chrysen-1-yl]propanal |
|---|---|
| PubChem CID | 162887037 |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.38 |
| IUPAC Name | 3-[(1S,2S,4aS,4bS,6aR,7R,10aS,10bR,12aR)-7-hydroxy-1,4a,4b,8,8,10a-hexamethyl-2-prop-1-en-2-yl-3,4,5,6,6a,7,9,10,10b,11,12,12a-dodecahydro-2H-chrysen-1-yl]propanal |
| SMILES | C=C(C)[C@@H]1CC[C@@]2(C)[C@H](CC[C@@H]3[C@]4(C)CCC(C)(C)[C@H](O)[C@@H]4CC[C@@]32C)[C@@]1(C)CCC=O |
| InChI | InChI=1S/C30H50O2/c1-20(2)21-12-15-29(7)23(27(21,5)14-9-19-31)10-11-24-28(6)18-17-26(3,4)25(32)22(28)13-16-30(24,29)8/h19,21-25,32H,1,9-18H2,2-8H3/t21-,22-,23+,24+,25+,27-,28+,29-,30-/m0/s1 |
| InChIKey | IMZJFFRPDSNASW-VLXMDZSCSA-N |
| XLogP | 7.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|