C30H48O3 — CID 162953271
10-hydroxy-6,9,9,14,15,19,19-heptamethyl-21-oxahexacyclo[18.2.2.01,18.02,15.05,14.06,11]tetracosan-22-one (PubChem CID 162953271) has the molecular formula C30H48O3 and a molecular weight of 456.71 g/mol. Its IUPAC name is 10-hydroxy-6,9,9,14,15,19,19-heptamethyl-21-oxahexacyclo[18.2.2.01,18.02,15.05,14.06,11]tetracosan-22-one.
| Compound Name | 10-hydroxy-6,9,9,14,15,19,19-heptamethyl-21-oxahexacyclo[18.2.2.01,18.02,15.05,14.06,11]tetracosan-22-one |
|---|---|
| PubChem CID | 162953271 |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | 10-hydroxy-6,9,9,14,15,19,19-heptamethyl-21-oxahexacyclo[18.2.2.01,18.02,15.05,14.06,11]tetracosan-22-one |
| SMILES | CC1(C)CCC2(C)C(CCC3(C)C2CCC2C45CCC(OC4=O)C(C)(C)C5CCC23C)C1O |
| InChI | InChI=1S/C30H48O3/c1-25(2)16-17-27(5)18(23(25)31)10-13-28(6)20(27)8-9-21-29(28,7)14-11-19-26(3,4)22-12-15-30(19,21)24(32)33-22/h18-23,31H,8-17H2,1-7H3 |
| InChIKey | PVANKMHCCCUCAQ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |