C30H46O3 — CID 5458796
(1S,2R,3S,6R,7S,10R,11S,14R,15R,18R,20S)-2,7,14,15,19,19-hexamethyl-10-prop-1-en-2-yl-21,23-dioxahexacyclo[18.2.1.02,18.03,15.06,14.07,11]tricosan-22-one (PubChem CID 5458796) has the molecular formula C30H46O3 and a molecular weight of 454.70 g/mol. Its IUPAC name is (1S,2R,3S,6R,7S,10R,11S,14R,15R,18R,20S)-2,7,14,15,19,19-hexamethyl-10-prop-1-en-2-yl-21,23-dioxahexacyclo[18.2.1.02,18.03,15.06,14.07,11]tricosan-22-one.
| Compound Name | (1S,2R,3S,6R,7S,10R,11S,14R,15R,18R,20S)-2,7,14,15,19,19-hexamethyl-10-prop-1-en-2-yl-21,23-dioxahexacyclo[18.2.1.02,18.03,15.06,14.07,11]tricosan-22-one |
|---|---|
| PubChem CID | 5458796 |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | (1S,2R,3S,6R,7S,10R,11S,14R,15R,18R,20S)-2,7,14,15,19,19-hexamethyl-10-prop-1-en-2-yl-21,23-dioxahexacyclo[18.2.1.02,18.03,15.06,14.07,11]tricosan-22-one |
| SMILES | C=C(C)[C@@H]1CC[C@]2(C)[C@H]3CC[C@@H]4[C@@]5(C)[C@@H]6O[C@@H](OC6=O)C(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C30H46O3/c1-17(2)18-11-14-27(5)19(18)12-15-28(6)21(27)9-10-22-29(28,7)16-13-20-26(3,4)25-32-23(24(31)33-25)30(20,22)8/h18-23,25H,1,9-16H2,2-8H3/t18-,19-,20-,21+,22-,23+,25-,27-,28+,29+,30-/m0/s1 |
| InChIKey | JKVLECODSCOIBO-IJXBPPAZSA-N |
| XLogP | 7.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|