C32H52O2 — CID 162957363
methyl 5a,5b,8,8,11a,13b-hexamethyl-3-prop-1-en-2-yl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysene-9-carboxylate (PubChem CID 162957363) has the molecular formula C32H52O2 and a molecular weight of 468.77 g/mol. Its IUPAC name is methyl 5a,5b,8,8,11a,13b-hexamethyl-3-prop-1-en-2-yl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysene-9-carboxylate.
| Compound Name | methyl 5a,5b,8,8,11a,13b-hexamethyl-3-prop-1-en-2-yl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysene-9-carboxylate |
|---|---|
| PubChem CID | 162957363 |
| Molecular Formula | C32H52O2 |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.40 |
| IUPAC Name | methyl 5a,5b,8,8,11a,13b-hexamethyl-3-prop-1-en-2-yl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysene-9-carboxylate |
| SMILES | C=C(C)C1CCC2(C)C1CCC1(C)C2CCC2C3(C)CCC(C(=O)OC)C(C)(C)C3CCC21C |
| InChI | InChI=1S/C32H52O2/c1-20(2)21-12-16-29(5)22(21)14-18-31(7)25(29)10-11-26-30(6)17-13-23(27(33)34-9)28(3,4)24(30)15-19-32(26,31)8/h21-26H,1,10-19H2,2-9H3 |
| InChIKey | JXXFBLSQWGILMO-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|