C30H48O3 — CID 78200701
14-hydroxy-5,10,13,18,18-pentamethyl-9-propan-2-yl-23-oxahexacyclo[13.6.2.01,17.02,14.05,13.06,10]tricosan-22-one (PubChem CID 78200701) has the molecular formula C30H48O3 and a molecular weight of 456.71 g/mol. Its IUPAC name is 14-hydroxy-5,10,13,18,18-pentamethyl-9-propan-2-yl-23-oxahexacyclo[13.6.2.01,17.02,14.05,13.06,10]tricosan-22-one.
| Compound Name | 14-hydroxy-5,10,13,18,18-pentamethyl-9-propan-2-yl-23-oxahexacyclo[13.6.2.01,17.02,14.05,13.06,10]tricosan-22-one |
|---|---|
| PubChem CID | 78200701 |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | 14-hydroxy-5,10,13,18,18-pentamethyl-9-propan-2-yl-23-oxahexacyclo[13.6.2.01,17.02,14.05,13.06,10]tricosan-22-one |
| SMILES | CC(C)C1CCC2C1(C)CCC1(C)C2(C)CCC2C34CCCC(C)(C)C3CC(OC4=O)C21O |
| InChI | InChI=1S/C30H48O3/c1-18(2)19-9-10-20-26(19,5)15-16-28(7)27(20,6)14-11-21-29-13-8-12-25(3,4)22(29)17-23(30(21,28)32)33-24(29)31/h18-23,32H,8-17H2,1-7H3 |
| InChIKey | AWKQCEWSSUBAJV-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |