C30H48O — CID 163036908
(1R,2R,5S,6R,9R,10R,13R,14S,17R,19R)-2,5,10,13,17-pentamethyl-18-methylidene-9-propan-2-yl-22-oxahexacyclo[17.2.1.01,17.02,14.05,13.06,10]docosane (PubChem CID 163036908) has the molecular formula C30H48O and a molecular weight of 424.71 g/mol. Its IUPAC name is (1R,2R,5S,6R,9R,10R,13R,14S,17R,19R)-2,5,10,13,17-pentamethyl-18-methylidene-9-propan-2-yl-22-oxahexacyclo[17.2.1.01,17.02,14.05,13.06,10]docosane.
| Compound Name | (1R,2R,5S,6R,9R,10R,13R,14S,17R,19R)-2,5,10,13,17-pentamethyl-18-methylidene-9-propan-2-yl-22-oxahexacyclo[17.2.1.01,17.02,14.05,13.06,10]docosane |
|---|---|
| PubChem CID | 163036908 |
| Molecular Formula | C30H48O |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 424.37 |
| IUPAC Name | (1R,2R,5S,6R,9R,10R,13R,14S,17R,19R)-2,5,10,13,17-pentamethyl-18-methylidene-9-propan-2-yl-22-oxahexacyclo[17.2.1.01,17.02,14.05,13.06,10]docosane |
| SMILES | C=C1[C@H]2CC[C@]3(O2)[C@]1(C)CC[C@@H]1[C@@]3(C)CC[C@@]2(C)[C@@H]3CC[C@H](C(C)C)[C@@]3(C)CC[C@]12C |
| InChI | InChI=1S/C30H48O/c1-19(2)21-9-10-23-25(21,4)15-16-28(7)24-12-13-26(5)20(3)22-11-14-30(26,31-22)29(24,8)18-17-27(23,28)6/h19,21-24H,3,9-18H2,1-2,4-8H3/t21-,22-,23-,24+,25-,26-,27+,28-,29-,30+/m1/s1 |
| InChIKey | XOBFLGLRWURRDQ-RZBGFTHWSA-N |
| XLogP | 8.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|