C30H50O — CID 162895785
1,2,11,15,19,19-hexamethyl-7-propan-2-yl-6-oxahexacyclo[12.8.0.02,11.05,7.05,10.015,20]docosane (PubChem CID 162895785) has the molecular formula C30H50O and a molecular weight of 426.73 g/mol. Its IUPAC name is 1,2,11,15,19,19-hexamethyl-7-propan-2-yl-6-oxahexacyclo[12.8.0.02,11.05,7.05,10.015,20]docosane.
| Compound Name | 1,2,11,15,19,19-hexamethyl-7-propan-2-yl-6-oxahexacyclo[12.8.0.02,11.05,7.05,10.015,20]docosane |
|---|---|
| PubChem CID | 162895785 |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | 1,2,11,15,19,19-hexamethyl-7-propan-2-yl-6-oxahexacyclo[12.8.0.02,11.05,7.05,10.015,20]docosane |
| SMILES | CC(C)C12CCC3C4(C)CCC5C6(C)CCCC(C)(C)C6CCC5(C)C4(C)CCC31O2 |
| InChI | InChI=1S/C30H50O/c1-20(2)29-17-12-23-27(7)16-11-22-25(5)14-9-13-24(3,4)21(25)10-15-26(22,6)28(27,8)18-19-30(23,29)31-29/h20-23H,9-19H2,1-8H3 |
| InChIKey | CJXHILZQEKJJEE-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|