C30H46O4 — CID 162890997
16-hydroxy-6-(4-hydroxy-4-methylpentyl)-2,6,13,19,19-pentamethyl-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(20),11-dien-8-one (PubChem CID 162890997) has the molecular formula C30H46O4 and a molecular weight of 470.69 g/mol. Its IUPAC name is 16-hydroxy-6-(4-hydroxy-4-methylpentyl)-2,6,13,19,19-pentamethyl-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(20),11-dien-8-one.
| Compound Name | 16-hydroxy-6-(4-hydroxy-4-methylpentyl)-2,6,13,19,19-pentamethyl-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(20),11-dien-8-one |
|---|---|
| PubChem CID | 162890997 |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | 16-hydroxy-6-(4-hydroxy-4-methylpentyl)-2,6,13,19,19-pentamethyl-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(20),11-dien-8-one |
| SMILES | CC(C)(O)CCCC1(C)OC(=O)C23CC=C4C(=CC(C)(C)C5CC(O)CCC45C)C2(C)CCC13 |
| InChI | InChI=1S/C30H46O4/c1-25(2)18-21-20(27(5)14-9-19(31)17-23(25)27)10-16-30-22(11-15-28(21,30)6)29(7,34-24(30)32)13-8-12-26(3,4)33/h10,18-19,22-23,31,33H,8-9,11-17H2,1-7H3 |
| InChIKey | VDTQNMREIIRFPR-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |