C20H30O2 — CID 162896368
4a,8,8-trimethyl-4-[(3-methylfuran-2-yl)methyl]-3-methylidene-2,4,5,6,7,8a-hexahydro-1H-naphthalen-2-ol (PubChem CID 162896368) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 4a,8,8-trimethyl-4-[(3-methylfuran-2-yl)methyl]-3-methylidene-2,4,5,6,7,8a-hexahydro-1H-naphthalen-2-ol.
| Compound Name | 4a,8,8-trimethyl-4-[(3-methylfuran-2-yl)methyl]-3-methylidene-2,4,5,6,7,8a-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 162896368 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 4a,8,8-trimethyl-4-[(3-methylfuran-2-yl)methyl]-3-methylidene-2,4,5,6,7,8a-hexahydro-1H-naphthalen-2-ol |
| SMILES | C=C1C(O)CC2C(C)(C)CCCC2(C)C1Cc1occc1C |
| InChI | InChI=1S/C20H30O2/c1-13-7-10-22-17(13)11-15-14(2)16(21)12-18-19(3,4)8-6-9-20(15,18)5/h7,10,15-16,18,21H,2,6,8-9,11-12H2,1,3-5H3 |
| InChIKey | RHGPNSHMEJUHGA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|