C25H33Cl2N5O8 — CID 162898164
17,18-dichloro-3,13-bis(1-hydroxyethyl)-10-(hydroxymethyl)-7-phenyl-1,4,8,11,14-pentazabicyclo[14.3.0]nonadecane-2,5,9,12,15-pentone (PubChem CID 162898164) has the molecular formula C25H33Cl2N5O8 and a molecular weight of 602.47 g/mol. Its IUPAC name is 17,18-dichloro-3,13-bis(1-hydroxyethyl)-10-(hydroxymethyl)-7-phenyl-1,4,8,11,14-pentazabicyclo[14.3.0]nonadecane-2,5,9,12,15-pentone.
| Compound Name | 17,18-dichloro-3,13-bis(1-hydroxyethyl)-10-(hydroxymethyl)-7-phenyl-1,4,8,11,14-pentazabicyclo[14.3.0]nonadecane-2,5,9,12,15-pentone |
|---|---|
| PubChem CID | 162898164 |
| Molecular Formula | C25H33Cl2N5O8 |
| Molecular Weight | 602.47 g/mol |
| Exact Mass | 601.17 |
| IUPAC Name | 17,18-dichloro-3,13-bis(1-hydroxyethyl)-10-(hydroxymethyl)-7-phenyl-1,4,8,11,14-pentazabicyclo[14.3.0]nonadecane-2,5,9,12,15-pentone |
| SMILES | CC(O)C1NC(=O)C2C(Cl)C(Cl)CN2C(=O)C(C(C)O)NC(=O)CC(c2ccccc2)NC(=O)C(CO)NC1=O |
| InChI | InChI=1S/C25H33Cl2N5O8/c1-11(34)19-23(38)29-16(10-33)22(37)28-15(13-6-4-3-5-7-13)8-17(36)30-20(12(2)35)25(40)32-9-14(26)18(27)21(32)24(39)31-19/h3-7,11-12,14-16,18-21,33-35H,8-10H2,1-2H3,(H,28,37)(H,29,38)(H,30,36)(H,31,39) |
| InChIKey | DURHAIKRNROMJV-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 197.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.47 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|