C24H33N5O6 — CID 163096507
(3S,7R,10S,13S,16S)-13-ethyl-10-(hydroxymethyl)-3-methyl-7-phenyl-1,4,8,11,14-pentazabicyclo[14.3.0]nonadecane-2,5,9,12,15-pentone (PubChem CID 163096507) has the molecular formula C24H33N5O6 and a molecular weight of 487.56 g/mol. Its IUPAC name is (3S,7R,10S,13S,16S)-13-ethyl-10-(hydroxymethyl)-3-methyl-7-phenyl-1,4,8,11,14-pentazabicyclo[14.3.0]nonadecane-2,5,9,12,15-pentone.
| Compound Name | (3S,7R,10S,13S,16S)-13-ethyl-10-(hydroxymethyl)-3-methyl-7-phenyl-1,4,8,11,14-pentazabicyclo[14.3.0]nonadecane-2,5,9,12,15-pentone |
|---|---|
| PubChem CID | 163096507 |
| Molecular Formula | C24H33N5O6 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | (3S,7R,10S,13S,16S)-13-ethyl-10-(hydroxymethyl)-3-methyl-7-phenyl-1,4,8,11,14-pentazabicyclo[14.3.0]nonadecane-2,5,9,12,15-pentone |
| SMILES | CC[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@H](C)NC(=O)C[C@H](c2ccccc2)NC(=O)[C@H](CO)NC1=O |
| InChI | InChI=1S/C24H33N5O6/c1-3-16-21(32)28-18(13-30)22(33)27-17(15-8-5-4-6-9-15)12-20(31)25-14(2)24(35)29-11-7-10-19(29)23(34)26-16/h4-6,8-9,14,16-19,30H,3,7,10-13H2,1-2H3,(H,25,31)(H,26,34)(H,27,33)(H,28,32)/t14-,16-,17+,18-,19-/m0/s1 |
| InChIKey | KPYCXFJWFIIGOV-UJCHZGTJSA-N |
| XLogP | -0.88 |
| TPSA | 156.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |