C25H32ClN5O7 — CID 163086869
(3S,7R,10R,13S,16R)-19-chloro-3-ethyl-13-[(1S)-1-hydroxyethyl]-10-(hydroxymethyl)-7-phenyl-1,4,8,11,14-pentazabicyclo[14.3.0]nonadec-18-ene-2,5,9,12,15-pentone (PubChem CID 163086869) has the molecular formula C25H32ClN5O7 and a molecular weight of 550.01 g/mol. Its IUPAC name is (3S,7R,10R,13S,16R)-19-chloro-3-ethyl-13-[(1S)-1-hydroxyethyl]-10-(hydroxymethyl)-7-phenyl-1,4,8,11,14-pentazabicyclo[14.3.0]nonadec-18-ene-2,5,9,12,15-pentone.
| Compound Name | (3S,7R,10R,13S,16R)-19-chloro-3-ethyl-13-[(1S)-1-hydroxyethyl]-10-(hydroxymethyl)-7-phenyl-1,4,8,11,14-pentazabicyclo[14.3.0]nonadec-18-ene-2,5,9,12,15-pentone |
|---|---|
| PubChem CID | 163086869 |
| Molecular Formula | C25H32ClN5O7 |
| Molecular Weight | 550.01 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | (3S,7R,10R,13S,16R)-19-chloro-3-ethyl-13-[(1S)-1-hydroxyethyl]-10-(hydroxymethyl)-7-phenyl-1,4,8,11,14-pentazabicyclo[14.3.0]nonadec-18-ene-2,5,9,12,15-pentone |
| SMILES | CC[C@@H]1NC(=O)C[C@H](c2ccccc2)NC(=O)[C@@H](CO)NC(=O)[C@H]([C@H](C)O)NC(=O)[C@H]2CC=C(Cl)N2C1=O |
| InChI | InChI=1S/C25H32ClN5O7/c1-3-15-25(38)31-18(9-10-19(31)26)23(36)30-21(13(2)33)24(37)29-17(12-32)22(35)28-16(11-20(34)27-15)14-7-5-4-6-8-14/h4-8,10,13,15-18,21,32-33H,3,9,11-12H2,1-2H3,(H,27,34)(H,28,35)(H,29,37)(H,30,36)/t13-,15-,16+,17+,18+,21-/m0/s1 |
| InChIKey | SFQJOHPCVIPIAK-NRJDFDKSSA-N |
| XLogP | -0.83 |
| TPSA | 177.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.01 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|