C22H28O9 — CID 162899420
[(3aR,4S,6E,10Z,11aR)-7-hydroxy-10-(hydroxymethyl)-6-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (E)-4-acetyloxy-2-(hydroxymethyl)but-2-enoate (PubChem CID 162899420) has the molecular formula C22H28O9 and a molecular weight of 436.46 g/mol. Its IUPAC name is [(3aR,4S,6E,10Z,11aR)-7-hydroxy-10-(hydroxymethyl)-6-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (E)-4-acetyloxy-2-(hydroxymethyl)but-2-enoate.
| Compound Name | [(3aR,4S,6E,10Z,11aR)-7-hydroxy-10-(hydroxymethyl)-6-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (E)-4-acetyloxy-2-(hydroxymethyl)but-2-enoate |
|---|---|
| PubChem CID | 162899420 |
| Molecular Formula | C22H28O9 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | [(3aR,4S,6E,10Z,11aR)-7-hydroxy-10-(hydroxymethyl)-6-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (E)-4-acetyloxy-2-(hydroxymethyl)but-2-enoate |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\CO)CC/C(O)=C(/C)C[C@H](OC(=O)/C(=C/COC(C)=O)CO)[C@@H]12 |
| InChI | InChI=1S/C22H28O9/c1-12-8-18(31-22(28)16(11-24)6-7-29-14(3)25)20-13(2)21(27)30-19(20)9-15(10-23)4-5-17(12)26/h6,9,18-20,23-24,26H,2,4-5,7-8,10-11H2,1,3H3/b15-9-,16-6+,17-12+/t18-,19+,20+/m0/s1 |
| InChIKey | WWSVFCWEYPZVKN-JFQNOBTPSA-N |
| XLogP | 1.41 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|