C25H38O4 — CID 162903777
(2S)-2-hydroxy-2,4-dimethyl-5-[(2E,4E,6S,7E,10S,12S)-4,6,8,10,12-pentamethyl-9-oxotetradeca-2,4,7-trien-2-yl]furan-3-one (PubChem CID 162903777) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is (2S)-2-hydroxy-2,4-dimethyl-5-[(2E,4E,6S,7E,10S,12S)-4,6,8,10,12-pentamethyl-9-oxotetradeca-2,4,7-trien-2-yl]furan-3-one.
| Compound Name | (2S)-2-hydroxy-2,4-dimethyl-5-[(2E,4E,6S,7E,10S,12S)-4,6,8,10,12-pentamethyl-9-oxotetradeca-2,4,7-trien-2-yl]furan-3-one |
|---|---|
| PubChem CID | 162903777 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | (2S)-2-hydroxy-2,4-dimethyl-5-[(2E,4E,6S,7E,10S,12S)-4,6,8,10,12-pentamethyl-9-oxotetradeca-2,4,7-trien-2-yl]furan-3-one |
| SMILES | CC[C@H](C)C[C@H](C)C(=O)/C(C)=C/[C@@H](C)/C=C(C)/C=C(\C)C1=C(C)C(=O)[C@@](C)(O)O1 |
| InChI | InChI=1S/C25H38O4/c1-10-15(2)12-18(5)22(26)19(6)13-16(3)11-17(4)14-20(7)23-21(8)24(27)25(9,28)29-23/h11,13-16,18,28H,10,12H2,1-9H3/b17-11+,19-13+,20-14+/t15-,16-,18-,25-/m0/s1 |
| InChIKey | YOBDLCSLLGWPFE-NGWQFGDGSA-N |
| XLogP | 5.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|