C20H32O3 — CID 163186832
(2S)-2-hydroxy-2,4-dimethyl-5-[(2E,4E,6S,8S)-4,6,8-trimethylundeca-2,4-dien-2-yl]furan-3-one (PubChem CID 163186832) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (2S)-2-hydroxy-2,4-dimethyl-5-[(2E,4E,6S,8S)-4,6,8-trimethylundeca-2,4-dien-2-yl]furan-3-one.
| Compound Name | (2S)-2-hydroxy-2,4-dimethyl-5-[(2E,4E,6S,8S)-4,6,8-trimethylundeca-2,4-dien-2-yl]furan-3-one |
|---|---|
| PubChem CID | 163186832 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (2S)-2-hydroxy-2,4-dimethyl-5-[(2E,4E,6S,8S)-4,6,8-trimethylundeca-2,4-dien-2-yl]furan-3-one |
| SMILES | CCC[C@H](C)C[C@H](C)/C=C(C)/C=C(\C)C1=C(C)C(=O)[C@@](C)(O)O1 |
| InChI | InChI=1S/C20H32O3/c1-8-9-13(2)10-14(3)11-15(4)12-16(5)18-17(6)19(21)20(7,22)23-18/h11-14,22H,8-10H2,1-7H3/b15-11+,16-12+/t13-,14-,20-/m0/s1 |
| InChIKey | KZLGFUZEKMOLGG-MTNOHMLPSA-N |
| XLogP | 4.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|