C20H34O3 — CID 163001531
(2R)-2-hydroxy-2,4-dimethyl-5-[(E,4S,6S,8S)-4,6,8-trimethylundec-2-en-2-yl]furan-3-one (PubChem CID 163001531) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (2R)-2-hydroxy-2,4-dimethyl-5-[(E,4S,6S,8S)-4,6,8-trimethylundec-2-en-2-yl]furan-3-one.
| Compound Name | (2R)-2-hydroxy-2,4-dimethyl-5-[(E,4S,6S,8S)-4,6,8-trimethylundec-2-en-2-yl]furan-3-one |
|---|---|
| PubChem CID | 163001531 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (2R)-2-hydroxy-2,4-dimethyl-5-[(E,4S,6S,8S)-4,6,8-trimethylundec-2-en-2-yl]furan-3-one |
| SMILES | CCC[C@H](C)C[C@H](C)C[C@H](C)/C=C(\C)C1=C(C)C(=O)[C@](C)(O)O1 |
| InChI | InChI=1S/C20H34O3/c1-8-9-13(2)10-14(3)11-15(4)12-16(5)18-17(6)19(21)20(7,22)23-18/h12-15,22H,8-11H2,1-7H3/b16-12+/t13-,14-,15-,20+/m0/s1 |
| InChIKey | RZTZCYIQYLIOJI-MHLUXIIQSA-N |
| XLogP | 5.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |