C27H43NO2 — CID 162907941
(1R,6R,9S,10R,14S,15S,17R,18S,20S,23R,24R)-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-2(11)-ene-17,20-diol (PubChem CID 162907941) has the molecular formula C27H43NO2 and a molecular weight of 413.65 g/mol. Its IUPAC name is (1R,6R,9S,10R,14S,15S,17R,18S,20S,23R,24R)-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-2(11)-ene-17,20-diol.
| Compound Name | (1R,6R,9S,10R,14S,15S,17R,18S,20S,23R,24R)-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-2(11)-ene-17,20-diol |
|---|---|
| PubChem CID | 162907941 |
| Molecular Formula | C27H43NO2 |
| Molecular Weight | 413.65 g/mol |
| Exact Mass | 413.33 |
| IUPAC Name | (1R,6R,9S,10R,14S,15S,17R,18S,20S,23R,24R)-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-2(11)-ene-17,20-diol |
| SMILES | C[C@@H]1CC[C@H]2[C@H](C)C3=C(CN2C1)[C@@H]1C[C@@H]2[C@@H](C[C@@H](O)[C@H]4C[C@@H](O)CC[C@]24C)[C@@H]1CC3 |
| InChI | InChI=1S/C27H43NO2/c1-15-4-7-25-16(2)18-5-6-19-20(22(18)14-28(25)13-15)11-23-21(19)12-26(30)24-10-17(29)8-9-27(23,24)3/h15-17,19-21,23-26,29-30H,4-14H2,1-3H3/t15-,16-,17+,19-,20-,21+,23-,24-,25+,26-,27-/m1/s1 |
| InChIKey | OEJGVNMSFPGDPP-VLBNVIFKSA-N |
| XLogP | 4.63 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.65 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|