C27H43NO3 — CID 162890081
(6S,9S,10R,11R,13S,14S,15R,17R,18S,20R,23R,24S)-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-1-ene-13,17,20-triol (PubChem CID 162890081) has the molecular formula C27H43NO3 and a molecular weight of 429.65 g/mol. Its IUPAC name is (6S,9S,10R,11R,13S,14S,15R,17R,18S,20R,23R,24S)-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-1-ene-13,17,20-triol.
| Compound Name | (6S,9S,10R,11R,13S,14S,15R,17R,18S,20R,23R,24S)-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-1-ene-13,17,20-triol |
|---|---|
| PubChem CID | 162890081 |
| Molecular Formula | C27H43NO3 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.32 |
| IUPAC Name | (6S,9S,10R,11R,13S,14S,15R,17R,18S,20R,23R,24S)-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-1-ene-13,17,20-triol |
| SMILES | C[C@H]1CC[C@H]2[C@H](C)[C@H]3C[C@H](O)[C@@H]4C(=C3CN2C1)C[C@H]1[C@H]4C[C@@H](O)[C@H]2C[C@H](O)CC[C@@]21C |
| InChI | InChI=1S/C27H43NO3/c1-14-4-5-23-15(2)17-10-25(31)26-18(20(17)13-28(23)12-14)9-21-19(26)11-24(30)22-8-16(29)6-7-27(21,22)3/h14-17,19,21-26,29-31H,4-13H2,1-3H3/t14-,15+,16+,17+,19+,21-,22+,23-,24+,25-,26+,27+/m0/s1 |
| InChIKey | ASNJVGVDAGWRBA-OSBKOZAVSA-N |
| XLogP | 3.60 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|