C22H26O7 — CID 162909675
(11-acetyloxy-3,6,10-trimethylidene-2,8-dioxo-4,5,11,11a-tetrahydro-3aH-cyclodeca[b]furan-4-yl) 2-methylbut-2-enoate (PubChem CID 162909675) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is (11-acetyloxy-3,6,10-trimethylidene-2,8-dioxo-4,5,11,11a-tetrahydro-3aH-cyclodeca[b]furan-4-yl) 2-methylbut-2-enoate.
| Compound Name | (11-acetyloxy-3,6,10-trimethylidene-2,8-dioxo-4,5,11,11a-tetrahydro-3aH-cyclodeca[b]furan-4-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162909675 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (11-acetyloxy-3,6,10-trimethylidene-2,8-dioxo-4,5,11,11a-tetrahydro-3aH-cyclodeca[b]furan-4-yl) 2-methylbut-2-enoate |
| SMILES | C=C1CC(=O)CC(=C)C(OC(C)=O)C2OC(=O)C(=C)C2C(OC(=O)C(C)=CC)C1 |
| InChI | InChI=1S/C22H26O7/c1-7-12(3)21(25)28-17-9-11(2)8-16(24)10-13(4)19(27-15(6)23)20-18(17)14(5)22(26)29-20/h7,17-20H,2,4-5,8-10H2,1,3,6H3 |
| InChIKey | SDYAXONOANGJQO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|