C18H28O4 — CID 162910919
(Z)-13-[(4S,5R)-4-hydroxy-5-methyl-2-oxooxolan-3-ylidene]tridec-2-enal (PubChem CID 162910919) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is (Z)-13-[(4S,5R)-4-hydroxy-5-methyl-2-oxooxolan-3-ylidene]tridec-2-enal.
| Compound Name | (Z)-13-[(4S,5R)-4-hydroxy-5-methyl-2-oxooxolan-3-ylidene]tridec-2-enal |
|---|---|
| PubChem CID | 162910919 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (Z)-13-[(4S,5R)-4-hydroxy-5-methyl-2-oxooxolan-3-ylidene]tridec-2-enal |
| SMILES | C[C@H]1OC(=O)C(=CCCCCCCCCC/C=C\C=O)[C@@H]1O |
| InChI | InChI=1S/C18H28O4/c1-15-17(20)16(18(21)22-15)13-11-9-7-5-3-2-4-6-8-10-12-14-19/h10,12-15,17,20H,2-9,11H2,1H3/b12-10-,16-13?/t15-,17-/m1/s1 |
| InChIKey | AZUPKVUOQZNWFX-YMBZEBNRSA-N |
| XLogP | 3.48 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|