C19H32O5 — CID 163002911
(3E,4S,5R)-3-[(E,11R)-11,14-dihydroxytetradec-12-enylidene]-4-hydroxy-5-methyloxolan-2-one (PubChem CID 163002911) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is (3E,4S,5R)-3-[(E,11R)-11,14-dihydroxytetradec-12-enylidene]-4-hydroxy-5-methyloxolan-2-one.
| Compound Name | (3E,4S,5R)-3-[(E,11R)-11,14-dihydroxytetradec-12-enylidene]-4-hydroxy-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 163002911 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (3E,4S,5R)-3-[(E,11R)-11,14-dihydroxytetradec-12-enylidene]-4-hydroxy-5-methyloxolan-2-one |
| SMILES | C[C@H]1OC(=O)/C(=C/CCCCCCCCC[C@@H](O)/C=C/CO)[C@@H]1O |
| InChI | InChI=1S/C19H32O5/c1-15-18(22)17(19(23)24-15)13-9-7-5-3-2-4-6-8-11-16(21)12-10-14-20/h10,12-13,15-16,18,20-22H,2-9,11,14H2,1H3/b12-10+,17-13+/t15-,16-,18-/m1/s1 |
| InChIKey | YIKMJZNPRZKFGN-ARPRWNNESA-N |
| XLogP | 2.64 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|