C21H36O3 — CID 162941518
(3E,4S,5S)-3-hexadec-15-enylidene-4-hydroxy-5-methyloxolan-2-one (PubChem CID 162941518) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is (3E,4S,5S)-3-hexadec-15-enylidene-4-hydroxy-5-methyloxolan-2-one.
| Compound Name | (3E,4S,5S)-3-hexadec-15-enylidene-4-hydroxy-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 162941518 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | (3E,4S,5S)-3-hexadec-15-enylidene-4-hydroxy-5-methyloxolan-2-one |
| SMILES | C=CCCCCCCCCCCCCC/C=C1/C(=O)O[C@@H](C)[C@H]1O |
| InChI | InChI=1S/C21H36O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-20(22)18(2)24-21(19)23/h3,17-18,20,22H,1,4-16H2,2H3/b19-17+/t18-,20+/m0/s1 |
| InChIKey | SKYACYVVYMWRPR-PZTJZYIESA-N |
| XLogP | 5.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|