C23H20O12 — CID 162911075
(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(3,8,9-trihydroxy-7-oxo-5,6-dihydrobenzo[c]xanthen-10-yl)oxy]oxane-2-carboxylic acid (PubChem CID 162911075) has the molecular formula C23H20O12 and a molecular weight of 488.40 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(3,8,9-trihydroxy-7-oxo-5,6-dihydrobenzo[c]xanthen-10-yl)oxy]oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(3,8,9-trihydroxy-7-oxo-5,6-dihydrobenzo[c]xanthen-10-yl)oxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 162911075 |
| Molecular Formula | C23H20O12 |
| Molecular Weight | 488.40 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(3,8,9-trihydroxy-7-oxo-5,6-dihydrobenzo[c]xanthen-10-yl)oxy]oxane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1O[C@H](Oc2cc3oc4c(c(=O)c3c(O)c2O)CCc2cc(O)ccc2-4)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H20O12/c24-8-2-4-9-7(5-8)1-3-10-14(25)13-11(33-20(9)10)6-12(15(26)16(13)27)34-23-19(30)17(28)18(29)21(35-23)22(31)32/h2,4-6,17-19,21,23-24,26-30H,1,3H2,(H,31,32)/t17-,18-,19+,21-,23-/m0/s1 |
| InChIKey | OKBNJYSQGAJVTK-XGKROOQSSA-N |
| XLogP | -0.05 |
| TPSA | 207.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.40 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|