C27H41NO4 — CID 162911436
(1S,2S,6S,9S,10S,11R,12S,14R,15R,23R,24S)-10,12,14-trihydroxy-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-18-en-20-one (PubChem CID 162911436) has the molecular formula C27H41NO4 and a molecular weight of 443.63 g/mol. Its IUPAC name is (1S,2S,6S,9S,10S,11R,12S,14R,15R,23R,24S)-10,12,14-trihydroxy-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-18-en-20-one.
| Compound Name | (1S,2S,6S,9S,10S,11R,12S,14R,15R,23R,24S)-10,12,14-trihydroxy-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-18-en-20-one |
|---|---|
| PubChem CID | 162911436 |
| Molecular Formula | C27H41NO4 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.30 |
| IUPAC Name | (1S,2S,6S,9S,10S,11R,12S,14R,15R,23R,24S)-10,12,14-trihydroxy-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-18-en-20-one |
| SMILES | C[C@H]1CC[C@@H]2N(C1)C[C@@H]1[C@H]([C@@H](O)C[C@@]3(O)[C@@H]4CCC5=CC(=O)CC[C@]5(C)[C@H]4C[C@@H]13)[C@]2(C)O |
| InChI | InChI=1S/C27H41NO4/c1-15-4-7-23-26(3,31)24-18(14-28(23)13-15)20-11-21-19(27(20,32)12-22(24)30)6-5-16-10-17(29)8-9-25(16,21)2/h10,15,18-24,30-32H,4-9,11-14H2,1-3H3/t15-,18-,19+,20-,21-,22-,23-,24+,25-,26+,27+/m0/s1 |
| InChIKey | ZKKWMLFTHMABAU-KVTZJQPTSA-N |
| XLogP | 2.92 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |