C19H22O7 — CID 162912790
(1S,2R,9S,10R,11R,12R,13R,16R)-4,9,12-trihydroxy-2,6,10,16-tetramethyl-14-oxatetracyclo[11.2.1.02,11.05,10]hexadeca-4,6-diene-3,8,15-trione (PubChem CID 162912790) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is (1S,2R,9S,10R,11R,12R,13R,16R)-4,9,12-trihydroxy-2,6,10,16-tetramethyl-14-oxatetracyclo[11.2.1.02,11.05,10]hexadeca-4,6-diene-3,8,15-trione.
| Compound Name | (1S,2R,9S,10R,11R,12R,13R,16R)-4,9,12-trihydroxy-2,6,10,16-tetramethyl-14-oxatetracyclo[11.2.1.02,11.05,10]hexadeca-4,6-diene-3,8,15-trione |
|---|---|
| PubChem CID | 162912790 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (1S,2R,9S,10R,11R,12R,13R,16R)-4,9,12-trihydroxy-2,6,10,16-tetramethyl-14-oxatetracyclo[11.2.1.02,11.05,10]hexadeca-4,6-diene-3,8,15-trione |
| SMILES | CC1=CC(=O)[C@@H](O)[C@@]2(C)C1=C(O)C(=O)[C@]1(C)[C@@H]2[C@@H](O)[C@@H]2OC(=O)[C@H]1[C@H]2C |
| InChI | InChI=1S/C19H22O7/c1-6-5-8(20)15(23)18(3)9(6)11(21)16(24)19(4)10-7(2)13(26-17(10)25)12(22)14(18)19/h5,7,10,12-15,21-23H,1-4H3/t7-,10-,12+,13-,14-,15-,18+,19+/m1/s1 |
| InChIKey | PPKSFEYKHZBQGA-XOTRNXFXSA-N |
| XLogP | 0.45 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |