C19H24O6 — CID 162945137
(1R,2S,8R,9R,10S,11S,12S,13S,16S)-8,9,12-trihydroxy-2,6,10,16-tetramethyl-14-oxatetracyclo[11.2.1.02,11.05,10]hexadeca-4,6-diene-3,15-dione (PubChem CID 162945137) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is (1R,2S,8R,9R,10S,11S,12S,13S,16S)-8,9,12-trihydroxy-2,6,10,16-tetramethyl-14-oxatetracyclo[11.2.1.02,11.05,10]hexadeca-4,6-diene-3,15-dione.
| Compound Name | (1R,2S,8R,9R,10S,11S,12S,13S,16S)-8,9,12-trihydroxy-2,6,10,16-tetramethyl-14-oxatetracyclo[11.2.1.02,11.05,10]hexadeca-4,6-diene-3,15-dione |
|---|---|
| PubChem CID | 162945137 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (1R,2S,8R,9R,10S,11S,12S,13S,16S)-8,9,12-trihydroxy-2,6,10,16-tetramethyl-14-oxatetracyclo[11.2.1.02,11.05,10]hexadeca-4,6-diene-3,15-dione |
| SMILES | CC1=C[C@@H](O)[C@H](O)[C@]2(C)C1=CC(=O)[C@@]1(C)[C@H]2[C@H](O)[C@H]2OC(=O)[C@@H]1[C@@H]2C |
| InChI | InChI=1S/C19H24O6/c1-7-5-10(20)16(23)18(3)9(7)6-11(21)19(4)12-8(2)14(25-17(12)24)13(22)15(18)19/h5-6,8,10,12-16,20,22-23H,1-4H3/t8-,10+,12-,13+,14-,15-,16-,18+,19+/m0/s1 |
| InChIKey | GAVAUJBDPWVDRK-QIMUOAJRSA-N |
| XLogP | 0.36 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |