C34H46N4O4 — CID 162915138
1-(3-hydroxypropyl)-2-methyl-3-[11,12,15-trihydroxy-2-(1H-indol-2-ylmethyl)-15-methyl-9-tetracyclo[9.6.2.01,6.014,19]nonadec-2-en-7-ynyl]guanidine (PubChem CID 162915138) has the molecular formula C34H46N4O4 and a molecular weight of 574.77 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-2-methyl-3-[11,12,15-trihydroxy-2-(1H-indol-2-ylmethyl)-15-methyl-9-tetracyclo[9.6.2.01,6.014,19]nonadec-2-en-7-ynyl]guanidine.
| Compound Name | 1-(3-hydroxypropyl)-2-methyl-3-[11,12,15-trihydroxy-2-(1H-indol-2-ylmethyl)-15-methyl-9-tetracyclo[9.6.2.01,6.014,19]nonadec-2-en-7-ynyl]guanidine |
|---|---|
| PubChem CID | 162915138 |
| Molecular Formula | C34H46N4O4 |
| Molecular Weight | 574.77 g/mol |
| Exact Mass | 574.35 |
| IUPAC Name | 1-(3-hydroxypropyl)-2-methyl-3-[11,12,15-trihydroxy-2-(1H-indol-2-ylmethyl)-15-methyl-9-tetracyclo[9.6.2.01,6.014,19]nonadec-2-en-7-ynyl]guanidine |
| SMILES | C/N=C(\NCCCO)NC1C#CC2CCC=C(Cc3cc4ccccc4[nH]3)C23CCC(C)(O)C2CC(O)C(O)(C1)C2C3 |
| InChI | InChI=1S/C34H46N4O4/c1-32(41)13-14-33-21-28-27(32)19-30(40)34(28,42)20-25(38-31(35-2)36-15-6-16-39)12-11-23(33)8-5-9-24(33)18-26-17-22-7-3-4-10-29(22)37-26/h3-4,7,9-10,17,23,25,27-28,30,37,39-42H,5-6,8,13-16,18-21H2,1-2H3,(H2,35,36,38) |
| InChIKey | VUEMYPHOOMGCHC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.77 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|