C23H31NO3 — CID 162831789
(1R,2R,3aS,4R,7S,8aS)-7-[3-(1H-indol-2-yl)prop-1-en-2-yl]-1,4-dimethyl-2,3,3a,5,6,7,8,8a-octahydroazulene-1,2,4-triol (PubChem CID 162831789) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is (1R,2R,3aS,4R,7S,8aS)-7-[3-(1H-indol-2-yl)prop-1-en-2-yl]-1,4-dimethyl-2,3,3a,5,6,7,8,8a-octahydroazulene-1,2,4-triol.
| Compound Name | (1R,2R,3aS,4R,7S,8aS)-7-[3-(1H-indol-2-yl)prop-1-en-2-yl]-1,4-dimethyl-2,3,3a,5,6,7,8,8a-octahydroazulene-1,2,4-triol |
|---|---|
| PubChem CID | 162831789 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | (1R,2R,3aS,4R,7S,8aS)-7-[3-(1H-indol-2-yl)prop-1-en-2-yl]-1,4-dimethyl-2,3,3a,5,6,7,8,8a-octahydroazulene-1,2,4-triol |
| SMILES | C=C(Cc1cc2ccccc2[nH]1)[C@H]1CC[C@@](C)(O)[C@H]2C[C@@H](O)[C@](C)(O)[C@H]2C1 |
| InChI | InChI=1S/C23H31NO3/c1-14(10-17-11-16-6-4-5-7-20(16)24-17)15-8-9-22(2,26)18-13-21(25)23(3,27)19(18)12-15/h4-7,11,15,18-19,21,24-27H,1,8-10,12-13H2,2-3H3/t15-,18-,19-,21+,22+,23+/m0/s1 |
| InChIKey | UFAMYMLXQTVPNT-YZYAVBMNSA-N |
| XLogP | 3.57 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|