C28H38N4O2 — CID 162983248
1-[2-[(1R,2S,5R,6S,8R,9S)-1,5-dihydroxy-8-[3-(1H-indol-2-yl)prop-1-en-2-yl]-5-tricyclo[7.3.1.02,6]tridec-10-enyl]ethyl]-2-methylguanidine (PubChem CID 162983248) has the molecular formula C28H38N4O2 and a molecular weight of 462.64 g/mol. Its IUPAC name is 1-[2-[(1R,2S,5R,6S,8R,9S)-1,5-dihydroxy-8-[3-(1H-indol-2-yl)prop-1-en-2-yl]-5-tricyclo[7.3.1.02,6]tridec-10-enyl]ethyl]-2-methylguanidine.
| Compound Name | 1-[2-[(1R,2S,5R,6S,8R,9S)-1,5-dihydroxy-8-[3-(1H-indol-2-yl)prop-1-en-2-yl]-5-tricyclo[7.3.1.02,6]tridec-10-enyl]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 162983248 |
| Molecular Formula | C28H38N4O2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | 1-[2-[(1R,2S,5R,6S,8R,9S)-1,5-dihydroxy-8-[3-(1H-indol-2-yl)prop-1-en-2-yl]-5-tricyclo[7.3.1.02,6]tridec-10-enyl]ethyl]-2-methylguanidine |
| SMILES | C=C(Cc1cc2ccccc2[nH]1)[C@@H]1C[C@H]2[C@H](CC[C@@]2(O)CCN/C(N)=N/C)[C@@]2(O)CC=C[C@@H]1C2 |
| InChI | InChI=1S/C28H38N4O2/c1-18(14-21-15-19-6-3-4-8-25(19)32-21)22-16-24-23(28(34)10-5-7-20(22)17-28)9-11-27(24,33)12-13-31-26(29)30-2/h3-8,15,20,22-24,32-34H,1,9-14,16-17H2,2H3,(H3,29,30,31)/t20-,22+,23+,24+,27-,28-/m1/s1 |
| InChIKey | HMJPSFIAIIJVKC-JFGBPZHBSA-N |
| XLogP | 3.67 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|