C31H46N4O2 — CID 162943165
1-[2-[4-cyclohexyl-1,4-dihydroxy-7-[3-(1H-indol-2-yl)prop-1-en-2-yl]-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine (PubChem CID 162943165) has the molecular formula C31H46N4O2 and a molecular weight of 506.74 g/mol. Its IUPAC name is 1-[2-[4-cyclohexyl-1,4-dihydroxy-7-[3-(1H-indol-2-yl)prop-1-en-2-yl]-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine.
| Compound Name | 1-[2-[4-cyclohexyl-1,4-dihydroxy-7-[3-(1H-indol-2-yl)prop-1-en-2-yl]-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 162943165 |
| Molecular Formula | C31H46N4O2 |
| Molecular Weight | 506.74 g/mol |
| Exact Mass | 506.36 |
| IUPAC Name | 1-[2-[4-cyclohexyl-1,4-dihydroxy-7-[3-(1H-indol-2-yl)prop-1-en-2-yl]-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine |
| SMILES | C=C(Cc1cc2ccccc2[nH]1)C1CCC(O)(C2CCCCC2)C2CCC(O)(CCN/C(N)=N/C)C2C1 |
| InChI | InChI=1S/C31H46N4O2/c1-21(18-25-19-23-8-6-7-11-28(23)35-25)22-12-15-31(37,24-9-4-3-5-10-24)26-13-14-30(36,27(26)20-22)16-17-34-29(32)33-2/h6-8,11,19,22,24,26-27,35-37H,1,3-5,9-10,12-18,20H2,2H3,(H3,32,33,34) |
| InChIKey | GAGNQSOUHSJSLN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.74 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|