C31H46N4O3 — CID 163095556
1-[2-[(1R,2S,3R,6S,7R,8S,10S)-3,7-dihydroxy-10-[3-(1H-indol-2-yl)prop-1-en-2-yl]-7-methyl-3-tricyclo[6.2.2.02,6]dodecanyl]ethyl]-3-(3-hydroxypropyl)-2-methylguanidine (PubChem CID 163095556) has the molecular formula C31H46N4O3 and a molecular weight of 522.73 g/mol. Its IUPAC name is 1-[2-[(1R,2S,3R,6S,7R,8S,10S)-3,7-dihydroxy-10-[3-(1H-indol-2-yl)prop-1-en-2-yl]-7-methyl-3-tricyclo[6.2.2.02,6]dodecanyl]ethyl]-3-(3-hydroxypropyl)-2-methylguanidine.
| Compound Name | 1-[2-[(1R,2S,3R,6S,7R,8S,10S)-3,7-dihydroxy-10-[3-(1H-indol-2-yl)prop-1-en-2-yl]-7-methyl-3-tricyclo[6.2.2.02,6]dodecanyl]ethyl]-3-(3-hydroxypropyl)-2-methylguanidine |
|---|---|
| PubChem CID | 163095556 |
| Molecular Formula | C31H46N4O3 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.36 |
| IUPAC Name | 1-[2-[(1R,2S,3R,6S,7R,8S,10S)-3,7-dihydroxy-10-[3-(1H-indol-2-yl)prop-1-en-2-yl]-7-methyl-3-tricyclo[6.2.2.02,6]dodecanyl]ethyl]-3-(3-hydroxypropyl)-2-methylguanidine |
| SMILES | C=C(Cc1cc2ccccc2[nH]1)[C@H]1C[C@@H]2CC[C@H]1[C@H]1[C@H](CC[C@@]1(O)CCN/C(=N/C)NCCCO)[C@]2(C)O |
| InChI | InChI=1S/C31H46N4O3/c1-20(17-23-18-21-7-4-5-8-27(21)35-23)25-19-22-9-10-24(25)28-26(30(22,2)37)11-12-31(28,38)13-15-34-29(32-3)33-14-6-16-36/h4-5,7-8,18,22,24-26,28,35-38H,1,6,9-17,19H2,2-3H3,(H2,32,33,34)/t22-,24+,25+,26-,28-,30+,31+/m0/s1 |
| InChIKey | MKOHPSRNWAWBLT-XOAUTSKLSA-N |
| XLogP | 3.76 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|