C28H38N4O3 — CID 162867053
2-methyl-1-[2-[(1R,2S,4R,5R,6S,8R,9S)-1,4,5-trihydroxy-8-[3-(1H-indol-2-yl)prop-1-en-2-yl]-5-tricyclo[7.3.1.02,6]tridec-10-enyl]ethyl]guanidine (PubChem CID 162867053) has the molecular formula C28H38N4O3 and a molecular weight of 478.64 g/mol. Its IUPAC name is 2-methyl-1-[2-[(1R,2S,4R,5R,6S,8R,9S)-1,4,5-trihydroxy-8-[3-(1H-indol-2-yl)prop-1-en-2-yl]-5-tricyclo[7.3.1.02,6]tridec-10-enyl]ethyl]guanidine.
| Compound Name | 2-methyl-1-[2-[(1R,2S,4R,5R,6S,8R,9S)-1,4,5-trihydroxy-8-[3-(1H-indol-2-yl)prop-1-en-2-yl]-5-tricyclo[7.3.1.02,6]tridec-10-enyl]ethyl]guanidine |
|---|---|
| PubChem CID | 162867053 |
| Molecular Formula | C28H38N4O3 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | 2-methyl-1-[2-[(1R,2S,4R,5R,6S,8R,9S)-1,4,5-trihydroxy-8-[3-(1H-indol-2-yl)prop-1-en-2-yl]-5-tricyclo[7.3.1.02,6]tridec-10-enyl]ethyl]guanidine |
| SMILES | C=C(Cc1cc2ccccc2[nH]1)[C@@H]1C[C@H]2[C@H](C[C@@H](O)[C@@]2(O)CCN/C(N)=N/C)[C@@]2(O)CC=C[C@@H]1C2 |
| InChI | InChI=1S/C28H38N4O3/c1-17(12-20-13-18-6-3-4-8-24(18)32-20)21-14-23-22(27(34)9-5-7-19(21)16-27)15-25(33)28(23,35)10-11-31-26(29)30-2/h3-8,13,19,21-23,25,32-35H,1,9-12,14-16H2,2H3,(H3,29,30,31)/t19-,21+,22+,23+,25-,27-,28-/m1/s1 |
| InChIKey | DEWVZMGRCVNZMW-HIBIWEBESA-N |
| XLogP | 2.64 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|