C25H43N3O2 — CID 162830493
1-[2-[(1R,3aS,4R,7S,8aS)-7-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-1,4-dihydroxy-4-methyl-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine (PubChem CID 162830493) has the molecular formula C25H43N3O2 and a molecular weight of 417.64 g/mol. Its IUPAC name is 1-[2-[(1R,3aS,4R,7S,8aS)-7-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-1,4-dihydroxy-4-methyl-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine.
| Compound Name | 1-[2-[(1R,3aS,4R,7S,8aS)-7-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-1,4-dihydroxy-4-methyl-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 162830493 |
| Molecular Formula | C25H43N3O2 |
| Molecular Weight | 417.64 g/mol |
| Exact Mass | 417.34 |
| IUPAC Name | 1-[2-[(1R,3aS,4R,7S,8aS)-7-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-1,4-dihydroxy-4-methyl-2,3,3a,5,6,7,8,8a-octahydroazulen-1-yl]ethyl]-2-methylguanidine |
| SMILES | C/N=C(\N)NCC[C@]1(O)CC[C@H]2[C@@H]1C[C@@H](C1=CCC[C@H]3CCCC[C@@H]13)CC[C@@]2(C)O |
| InChI | InChI=1S/C25H43N3O2/c1-24(29)12-10-18(20-9-5-7-17-6-3-4-8-19(17)20)16-22-21(24)11-13-25(22,30)14-15-28-23(26)27-2/h9,17-19,21-22,29-30H,3-8,10-16H2,1-2H3,(H3,26,27,28)/t17-,18+,19-,21+,22+,24-,25-/m1/s1 |
| InChIKey | IANOPMUQDBFUEJ-DWZSISIWSA-N |
| XLogP | 3.75 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.64 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|