C25H41N3O2 — CID 162826018
1-[2-[8-(1-cyclohexylethenyl)-1,5-dihydroxy-5-tricyclo[7.3.1.02,6]tridec-10-enyl]ethyl]-2-methylguanidine (PubChem CID 162826018) has the molecular formula C25H41N3O2 and a molecular weight of 415.62 g/mol. Its IUPAC name is 1-[2-[8-(1-cyclohexylethenyl)-1,5-dihydroxy-5-tricyclo[7.3.1.02,6]tridec-10-enyl]ethyl]-2-methylguanidine.
| Compound Name | 1-[2-[8-(1-cyclohexylethenyl)-1,5-dihydroxy-5-tricyclo[7.3.1.02,6]tridec-10-enyl]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 162826018 |
| Molecular Formula | C25H41N3O2 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.32 |
| IUPAC Name | 1-[2-[8-(1-cyclohexylethenyl)-1,5-dihydroxy-5-tricyclo[7.3.1.02,6]tridec-10-enyl]ethyl]-2-methylguanidine |
| SMILES | C=C(C1CCCCC1)C1CC2C(CCC2(O)CCN/C(N)=N/C)C2(O)CC=CC1C2 |
| InChI | InChI=1S/C25H41N3O2/c1-17(18-7-4-3-5-8-18)20-15-22-21(25(30)11-6-9-19(20)16-25)10-12-24(22,29)13-14-28-23(26)27-2/h6,9,18-22,29-30H,1,3-5,7-8,10-16H2,2H3,(H3,26,27,28) |
| InChIKey | RIKBVNWYYIGJCA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|