C23H31NO — CID 163036226
5-(1H-indol-2-ylmethyl)-1,1,5,6-tetramethyl-2,3,4,4a,6,7-hexahydronaphthalen-2-ol (PubChem CID 163036226) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is 5-(1H-indol-2-ylmethyl)-1,1,5,6-tetramethyl-2,3,4,4a,6,7-hexahydronaphthalen-2-ol.
| Compound Name | 5-(1H-indol-2-ylmethyl)-1,1,5,6-tetramethyl-2,3,4,4a,6,7-hexahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 163036226 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | 5-(1H-indol-2-ylmethyl)-1,1,5,6-tetramethyl-2,3,4,4a,6,7-hexahydronaphthalen-2-ol |
| SMILES | CC1CC=C2C(CCC(O)C2(C)C)C1(C)Cc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H31NO/c1-15-9-10-18-19(11-12-21(25)22(18,2)3)23(15,4)14-17-13-16-7-5-6-8-20(16)24-17/h5-8,10,13,15,19,21,24-25H,9,11-12,14H2,1-4H3 |
| InChIKey | NWZFBXAZCWQDKL-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|