C20H34O3 — CID 162824177
(1R,2R,3aS,4R,7S,8aS)-7-(1-cyclohexylethenyl)-1,4-dimethyl-2,3,3a,5,6,7,8,8a-octahydroazulene-1,2,4-triol (PubChem CID 162824177) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (1R,2R,3aS,4R,7S,8aS)-7-(1-cyclohexylethenyl)-1,4-dimethyl-2,3,3a,5,6,7,8,8a-octahydroazulene-1,2,4-triol.
| Compound Name | (1R,2R,3aS,4R,7S,8aS)-7-(1-cyclohexylethenyl)-1,4-dimethyl-2,3,3a,5,6,7,8,8a-octahydroazulene-1,2,4-triol |
|---|---|
| PubChem CID | 162824177 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (1R,2R,3aS,4R,7S,8aS)-7-(1-cyclohexylethenyl)-1,4-dimethyl-2,3,3a,5,6,7,8,8a-octahydroazulene-1,2,4-triol |
| SMILES | C=C(C1CCCCC1)[C@H]1CC[C@@](C)(O)[C@H]2C[C@@H](O)[C@](C)(O)[C@H]2C1 |
| InChI | InChI=1S/C20H34O3/c1-13(14-7-5-4-6-8-14)15-9-10-19(2,22)16-12-18(21)20(3,23)17(16)11-15/h14-18,21-23H,1,4-12H2,2-3H3/t15-,16-,17-,18+,19+,20+/m0/s1 |
| InChIKey | LYHIIFRNRNRIRQ-IPJCAIGPSA-N |
| XLogP | 3.42 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|