C38H62O7 — CID 162915352
2-[3-[1-(2,3-dihydroxypropoxy)-10,14-dimethyl-6-methylidenepentadeca-2,4,9-trien-2-yl]-4,10-dihydroxy-6-(3-hydroxypropyl)-10-methylspiro[4.5]decan-7-ylidene]propanal (PubChem CID 162915352) has the molecular formula C38H62O7 and a molecular weight of 630.91 g/mol. Its IUPAC name is 2-[3-[1-(2,3-dihydroxypropoxy)-10,14-dimethyl-6-methylidenepentadeca-2,4,9-trien-2-yl]-4,10-dihydroxy-6-(3-hydroxypropyl)-10-methylspiro[4.5]decan-7-ylidene]propanal.
| Compound Name | 2-[3-[1-(2,3-dihydroxypropoxy)-10,14-dimethyl-6-methylidenepentadeca-2,4,9-trien-2-yl]-4,10-dihydroxy-6-(3-hydroxypropyl)-10-methylspiro[4.5]decan-7-ylidene]propanal |
|---|---|
| PubChem CID | 162915352 |
| Molecular Formula | C38H62O7 |
| Molecular Weight | 630.91 g/mol |
| Exact Mass | 630.45 |
| IUPAC Name | 2-[3-[1-(2,3-dihydroxypropoxy)-10,14-dimethyl-6-methylidenepentadeca-2,4,9-trien-2-yl]-4,10-dihydroxy-6-(3-hydroxypropyl)-10-methylspiro[4.5]decan-7-ylidene]propanal |
| SMILES | C=C(C=CC=C(COCC(O)CO)C1CCC2(C(CCCO)C(=C(C)C=O)CCC2(C)O)C1O)CCC=C(C)CCCC(C)C |
| InChI | InChI=1S/C38H62O7/c1-27(2)11-7-12-28(3)13-8-14-29(4)15-9-16-31(25-45-26-32(42)24-41)34-19-21-38(36(34)43)35(17-10-22-39)33(30(5)23-40)18-20-37(38,6)44/h9,13,15-16,23,27,32,34-36,39,41-44H,4,7-8,10-12,14,17-22,24-26H2,1-3,5-6H3 |
| InChIKey | SZTGJQWCAPKGOY-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.91 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|