C20H34O5 — CID 162917345
(3R,4aR,6aR,7S,10aS,10bR)-3-[(1S)-1,2-dihydroxyethyl]-3,4a,7,10a-tetramethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromene-7-carboxylic acid (PubChem CID 162917345) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is (3R,4aR,6aR,7S,10aS,10bR)-3-[(1S)-1,2-dihydroxyethyl]-3,4a,7,10a-tetramethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromene-7-carboxylic acid.
| Compound Name | (3R,4aR,6aR,7S,10aS,10bR)-3-[(1S)-1,2-dihydroxyethyl]-3,4a,7,10a-tetramethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromene-7-carboxylic acid |
|---|---|
| PubChem CID | 162917345 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (3R,4aR,6aR,7S,10aS,10bR)-3-[(1S)-1,2-dihydroxyethyl]-3,4a,7,10a-tetramethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromene-7-carboxylic acid |
| SMILES | C[C@]12CCC[C@](C)(C(=O)O)[C@@H]1CC[C@@]1(C)O[C@@](C)([C@@H](O)CO)CC[C@H]21 |
| InChI | InChI=1S/C20H34O5/c1-17-8-5-9-18(2,16(23)24)13(17)6-10-19(3)14(17)7-11-20(4,25-19)15(22)12-21/h13-15,21-22H,5-12H2,1-4H3,(H,23,24)/t13-,14-,15+,17+,18+,19-,20-/m1/s1 |
| InChIKey | HCDXIYYTHGLFFA-TXWGWWACSA-N |
| XLogP | 2.97 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |