C28H36O11 — CID 162917547
[1-(7-methoxy-1,3-benzodioxol-5-yl)-1-(2-methylbut-2-enoyloxy)propan-2-yl] 3-acetyloxy-2-methyl-2-(2-methylbut-2-enoyloxy)butanoate (PubChem CID 162917547) has the molecular formula C28H36O11 and a molecular weight of 548.59 g/mol. Its IUPAC name is [1-(7-methoxy-1,3-benzodioxol-5-yl)-1-(2-methylbut-2-enoyloxy)propan-2-yl] 3-acetyloxy-2-methyl-2-(2-methylbut-2-enoyloxy)butanoate.
| Compound Name | [1-(7-methoxy-1,3-benzodioxol-5-yl)-1-(2-methylbut-2-enoyloxy)propan-2-yl] 3-acetyloxy-2-methyl-2-(2-methylbut-2-enoyloxy)butanoate |
|---|---|
| PubChem CID | 162917547 |
| Molecular Formula | C28H36O11 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | [1-(7-methoxy-1,3-benzodioxol-5-yl)-1-(2-methylbut-2-enoyloxy)propan-2-yl] 3-acetyloxy-2-methyl-2-(2-methylbut-2-enoyloxy)butanoate |
| SMILES | CC=C(C)C(=O)OC(c1cc(OC)c2c(c1)OCO2)C(C)OC(=O)C(C)(OC(=O)C(C)=CC)C(C)OC(C)=O |
| InChI | InChI=1S/C28H36O11/c1-10-15(3)25(30)38-23(20-12-21(33-9)24-22(13-20)34-14-35-24)17(5)36-27(32)28(8,18(6)37-19(7)29)39-26(31)16(4)11-2/h10-13,17-18,23H,14H2,1-9H3 |
| InChIKey | NOALAEVAMMEDCB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|