C23H30O7 — CID 163031260
[1-(7-methoxy-1,3-benzodioxol-5-yl)-1-(2-methylpent-2-enoyloxy)propan-2-yl] 2-methylpent-2-enoate (PubChem CID 163031260) has the molecular formula C23H30O7 and a molecular weight of 418.49 g/mol. Its IUPAC name is [1-(7-methoxy-1,3-benzodioxol-5-yl)-1-(2-methylpent-2-enoyloxy)propan-2-yl] 2-methylpent-2-enoate.
| Compound Name | [1-(7-methoxy-1,3-benzodioxol-5-yl)-1-(2-methylpent-2-enoyloxy)propan-2-yl] 2-methylpent-2-enoate |
|---|---|
| PubChem CID | 163031260 |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | [1-(7-methoxy-1,3-benzodioxol-5-yl)-1-(2-methylpent-2-enoyloxy)propan-2-yl] 2-methylpent-2-enoate |
| SMILES | CCC=C(C)C(=O)OC(C)C(OC(=O)C(C)=CCC)c1cc(OC)c2c(c1)OCO2 |
| InChI | InChI=1S/C23H30O7/c1-7-9-14(3)22(24)29-16(5)20(30-23(25)15(4)10-8-2)17-11-18(26-6)21-19(12-17)27-13-28-21/h9-12,16,20H,7-8,13H2,1-6H3 |
| InChIKey | VNDVELGATHSJOM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|