C22H30O7 — CID 162918047
(1,6a,7-trihydroxy-4,4,8,11b-tetramethyl-9-oxo-1,4a,5,6,7,10a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-6-yl) acetate (PubChem CID 162918047) has the molecular formula C22H30O7 and a molecular weight of 406.48 g/mol. Its IUPAC name is (1,6a,7-trihydroxy-4,4,8,11b-tetramethyl-9-oxo-1,4a,5,6,7,10a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-6-yl) acetate.
| Compound Name | (1,6a,7-trihydroxy-4,4,8,11b-tetramethyl-9-oxo-1,4a,5,6,7,10a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-6-yl) acetate |
|---|---|
| PubChem CID | 162918047 |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (1,6a,7-trihydroxy-4,4,8,11b-tetramethyl-9-oxo-1,4a,5,6,7,10a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-6-yl) acetate |
| SMILES | CC(=O)OC1CC2C(C)(C)C=CC(O)C2(C)C2CC3OC(=O)C(C)=C3C(O)C12O |
| InChI | InChI=1S/C22H30O7/c1-10-17-12(29-19(10)26)8-14-21(5)13(20(3,4)7-6-15(21)24)9-16(28-11(2)23)22(14,27)18(17)25/h6-7,12-16,18,24-25,27H,8-9H2,1-5H3 |
| InChIKey | WVHUPAXIDXPOHK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|