C9H18O4 — CID 162918830
[(2R,3S,4S)-2,4-diethoxyoxolan-3-yl]methanol (PubChem CID 162918830) has the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. Its IUPAC name is [(2R,3S,4S)-2,4-diethoxyoxolan-3-yl]methanol.
| Compound Name | [(2R,3S,4S)-2,4-diethoxyoxolan-3-yl]methanol |
|---|---|
| PubChem CID | 162918830 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | [(2R,3S,4S)-2,4-diethoxyoxolan-3-yl]methanol |
| SMILES | CCO[C@@H]1OC[C@@H](OCC)[C@@H]1CO |
| InChI | InChI=1S/C9H18O4/c1-3-11-8-6-13-9(12-4-2)7(8)5-10/h7-10H,3-6H2,1-2H3/t7-,8+,9+/m0/s1 |
| InChIKey | OZCHIANHIUSSOX-DJLDLDEBSA-N |
| XLogP | 0.39 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |