C16H24O3 — CID 162919034
[(1R,3aS,4R,6R)-7-formyl-1,3,3,6-tetramethyl-1,2,3a,4,5,6-hexahydroinden-4-yl] acetate (PubChem CID 162919034) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is [(1R,3aS,4R,6R)-7-formyl-1,3,3,6-tetramethyl-1,2,3a,4,5,6-hexahydroinden-4-yl] acetate.
| Compound Name | [(1R,3aS,4R,6R)-7-formyl-1,3,3,6-tetramethyl-1,2,3a,4,5,6-hexahydroinden-4-yl] acetate |
|---|---|
| PubChem CID | 162919034 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | [(1R,3aS,4R,6R)-7-formyl-1,3,3,6-tetramethyl-1,2,3a,4,5,6-hexahydroinden-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H](C)C(C=O)=C2[C@H](C)CC(C)(C)[C@@H]21 |
| InChI | InChI=1S/C16H24O3/c1-9-6-13(19-11(3)18)15-14(12(9)8-17)10(2)7-16(15,4)5/h8-10,13,15H,6-7H2,1-5H3/t9-,10-,13-,15-/m1/s1 |
| InChIKey | HAEYAYBKSHUKRO-HMYIPDOQSA-N |
| XLogP | 3.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|