C19H22O9 — CID 162919267
2-methyl-5-(2-oxopropyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one (PubChem CID 162919267) has the molecular formula C19H22O9 and a molecular weight of 394.38 g/mol. Its IUPAC name is 2-methyl-5-(2-oxopropyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one.
| Compound Name | 2-methyl-5-(2-oxopropyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
|---|---|
| PubChem CID | 162919267 |
| Molecular Formula | C19H22O9 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-methyl-5-(2-oxopropyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| SMILES | CC(=O)Cc1cc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc2oc(C)cc(=O)c12 |
| InChI | InChI=1S/C19H22O9/c1-8(21)3-10-5-11(6-13-15(10)12(22)4-9(2)26-13)27-19-18(25)17(24)16(23)14(7-20)28-19/h4-6,14,16-20,23-25H,3,7H2,1-2H3/t14-,16-,17+,18-,19-/m1/s1 |
| InChIKey | AJXNNNQYHIIHLY-IQZDNPOKSA-N |
| XLogP | -0.59 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |