C16H20O3 — CID 162921301
methyl (2S)-2-[(1aR,1bS,6aS)-1b,6-dimethyl-3-oxo-1,1a,2,6a-tetrahydrocyclopropa[a]inden-4-yl]propanoate (PubChem CID 162921301) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is methyl (2S)-2-[(1aR,1bS,6aS)-1b,6-dimethyl-3-oxo-1,1a,2,6a-tetrahydrocyclopropa[a]inden-4-yl]propanoate.
| Compound Name | methyl (2S)-2-[(1aR,1bS,6aS)-1b,6-dimethyl-3-oxo-1,1a,2,6a-tetrahydrocyclopropa[a]inden-4-yl]propanoate |
|---|---|
| PubChem CID | 162921301 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | methyl (2S)-2-[(1aR,1bS,6aS)-1b,6-dimethyl-3-oxo-1,1a,2,6a-tetrahydrocyclopropa[a]inden-4-yl]propanoate |
| SMILES | COC(=O)[C@@H](C)C1=CC2=C(C)[C@H]3C[C@H]3[C@]2(C)CC1=O |
| InChI | InChI=1S/C16H20O3/c1-8-10-5-13(10)16(3)7-14(17)11(6-12(8)16)9(2)15(18)19-4/h6,9-10,13H,5,7H2,1-4H3/t9-,10+,13+,16+/m0/s1 |
| InChIKey | UJNUPYSAYCPRDL-YBFQDZRDSA-N |
| XLogP | 2.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |