C27H29NO12 — CID 162921632
(1R,3R,4R,5R)-3,4-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,5-dihydroxy-4-(methylaminomethyl)cyclohexane-1-carboxylic acid (PubChem CID 162921632) has the molecular formula C27H29NO12 and a molecular weight of 559.52 g/mol. Its IUPAC name is (1R,3R,4R,5R)-3,4-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,5-dihydroxy-4-(methylaminomethyl)cyclohexane-1-carboxylic acid.
| Compound Name | (1R,3R,4R,5R)-3,4-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,5-dihydroxy-4-(methylaminomethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 162921632 |
| Molecular Formula | C27H29NO12 |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | (1R,3R,4R,5R)-3,4-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,5-dihydroxy-4-(methylaminomethyl)cyclohexane-1-carboxylic acid |
| SMILES | CNC[C@@]1(OC(=O)C=Cc2ccc(O)c(O)c2)[C@H](O)C[C@](O)(C(=O)O)C[C@H]1OC(=O)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C27H29NO12/c1-28-14-27(40-24(35)9-5-16-3-7-18(30)20(32)11-16)21(33)12-26(38,25(36)37)13-22(27)39-23(34)8-4-15-2-6-17(29)19(31)10-15/h2-11,21-22,28-33,38H,12-14H2,1H3,(H,36,37)/t21-,22-,26-,27-/m1/s1 |
| InChIKey | ITKFGFSFIPTMRU-IKAXQFJBSA-N |
| XLogP | 0.62 |
| TPSA | 223.31 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|