C25H24O14 — CID 163177039
(1R,3R,4R,5R)-3-[3-(3,4-dihydroxyphenyl)-3-oxopropanoyl]oxy-4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,4,5-trihydroxycyclohexane-1-carboxylic acid (PubChem CID 163177039) has the molecular formula C25H24O14 and a molecular weight of 548.45 g/mol. Its IUPAC name is (1R,3R,4R,5R)-3-[3-(3,4-dihydroxyphenyl)-3-oxopropanoyl]oxy-4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,4,5-trihydroxycyclohexane-1-carboxylic acid.
| Compound Name | (1R,3R,4R,5R)-3-[3-(3,4-dihydroxyphenyl)-3-oxopropanoyl]oxy-4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,4,5-trihydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 163177039 |
| Molecular Formula | C25H24O14 |
| Molecular Weight | 548.45 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | (1R,3R,4R,5R)-3-[3-(3,4-dihydroxyphenyl)-3-oxopropanoyl]oxy-4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,4,5-trihydroxycyclohexane-1-carboxylic acid |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)O[C@]1(O)[C@H](O)C[C@](O)(C(=O)O)C[C@H]1OC(=O)CC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C25H24O14/c26-14-4-1-12(7-17(14)29)2-6-21(32)39-25(37)19(31)10-24(36,23(34)35)11-20(25)38-22(33)9-16(28)13-3-5-15(27)18(30)8-13/h1-8,19-20,26-27,29-31,36-37H,9-11H2,(H,34,35)/t19-,20-,24-,25-/m1/s1 |
| InChIKey | XRKLZRRICIKIKM-GQUJEBGOSA-N |
| XLogP | -0.09 |
| TPSA | 248.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.45 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|