C20H28O5 — CID 162922183
(4E,4aS,9R,11aR)-9-hydroperoxy-4-[(E)-4-hydroxy-4-methylpent-2-enylidene]-7,11-dimethylidene-5,6,8,9,10,11a-hexahydro-4aH-cyclonona[c]pyran-1-one (PubChem CID 162922183) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (4E,4aS,9R,11aR)-9-hydroperoxy-4-[(E)-4-hydroxy-4-methylpent-2-enylidene]-7,11-dimethylidene-5,6,8,9,10,11a-hexahydro-4aH-cyclonona[c]pyran-1-one.
| Compound Name | (4E,4aS,9R,11aR)-9-hydroperoxy-4-[(E)-4-hydroxy-4-methylpent-2-enylidene]-7,11-dimethylidene-5,6,8,9,10,11a-hexahydro-4aH-cyclonona[c]pyran-1-one |
|---|---|
| PubChem CID | 162922183 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (4E,4aS,9R,11aR)-9-hydroperoxy-4-[(E)-4-hydroxy-4-methylpent-2-enylidene]-7,11-dimethylidene-5,6,8,9,10,11a-hexahydro-4aH-cyclonona[c]pyran-1-one |
| SMILES | C=C1CC[C@@H]2/C(=C\C=C\C(C)(C)O)COC(=O)[C@H]2C(=C)C[C@H](OO)C1 |
| InChI | InChI=1S/C20H28O5/c1-13-7-8-17-15(6-5-9-20(3,4)22)12-24-19(21)18(17)14(2)11-16(10-13)25-23/h5-6,9,16-18,22-23H,1-2,7-8,10-12H2,3-4H3/b9-5+,15-6-/t16-,17-,18+/m1/s1 |
| InChIKey | REWCSPDCOFIPKP-KCJNRUAESA-N |
| XLogP | 3.57 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|