C20H34O3 — CID 162922332
(1R,3R,4E,7R,8Z,12S,13E)-1,5,9-trimethyl-12-propan-2-ylcyclotetradeca-4,8,13-triene-1,3,7-triol (PubChem CID 162922332) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (1R,3R,4E,7R,8Z,12S,13E)-1,5,9-trimethyl-12-propan-2-ylcyclotetradeca-4,8,13-triene-1,3,7-triol.
| Compound Name | (1R,3R,4E,7R,8Z,12S,13E)-1,5,9-trimethyl-12-propan-2-ylcyclotetradeca-4,8,13-triene-1,3,7-triol |
|---|---|
| PubChem CID | 162922332 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (1R,3R,4E,7R,8Z,12S,13E)-1,5,9-trimethyl-12-propan-2-ylcyclotetradeca-4,8,13-triene-1,3,7-triol |
| SMILES | C/C1=C/[C@H](O)C/C(C)=C/[C@H](O)C[C@@](C)(O)/C=C/[C@H](C(C)C)CC1 |
| InChI | InChI=1S/C20H34O3/c1-14(2)17-7-6-15(3)10-18(21)11-16(4)12-19(22)13-20(5,23)9-8-17/h8-10,12,14,17-19,21-23H,6-7,11,13H2,1-5H3/b9-8+,15-10-,16-12+/t17-,18+,19+,20+/m1/s1 |
| InChIKey | ZRUCLTHCKNSADG-HGRFLVSPSA-N |
| XLogP | 3.75 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|