C16H24O4 — CID 162923254
[(2S,3S,5S,8aR)-3-acetyloxy-5,8a-dimethyl-2,3,5,6,7,8-hexahydro-1H-naphthalen-2-yl] acetate (PubChem CID 162923254) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is [(2S,3S,5S,8aR)-3-acetyloxy-5,8a-dimethyl-2,3,5,6,7,8-hexahydro-1H-naphthalen-2-yl] acetate.
| Compound Name | [(2S,3S,5S,8aR)-3-acetyloxy-5,8a-dimethyl-2,3,5,6,7,8-hexahydro-1H-naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 162923254 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | [(2S,3S,5S,8aR)-3-acetyloxy-5,8a-dimethyl-2,3,5,6,7,8-hexahydro-1H-naphthalen-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C2[C@@H](C)CCC[C@]2(C)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H24O4/c1-10-6-5-7-16(4)9-15(20-12(3)18)14(8-13(10)16)19-11(2)17/h8,10,14-15H,5-7,9H2,1-4H3/t10-,14-,15-,16+/m0/s1 |
| InChIKey | OGDBCVYCURFRRJ-BLQKSXIESA-N |
| XLogP | 3.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|